C17H27FO4Si — CID 174694788
2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1,1,2-trimethylsilinane (PubChem CID 174694788) has the molecular formula C17H27FO4Si and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1,1,2-trimethylsilinane.
| Compound Name | 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1,1,2-trimethylsilinane |
|---|---|
| PubChem CID | 174694788 |
| Molecular Formula | C17H27FO4Si |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1,1,2-trimethylsilinane |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1F.CC1CCCC[Si]1(C)C |
| InChI | InChI=1S/C9H9FO4.C8H18Si/c1-9(8(13)14)4-2-3-5(6(9)10)7(11)12;1-8-6-4-5-7-9(8,2)3/h2-4,6H,1H3,(H,11,12)(H,13,14);8H,4-7H2,1-3H3 |
| InChIKey | FXLSIDNPEVVLFF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|