C16H15F2NO6 — CID 174847198
1-(difluoromethyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;nitrobenzene (PubChem CID 174847198) has the molecular formula C16H15F2NO6 and a molecular weight of 355.29 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;nitrobenzene.
| Compound Name | 1-(difluoromethyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;nitrobenzene |
|---|---|
| PubChem CID | 174847198 |
| Molecular Formula | C16H15F2NO6 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-(difluoromethyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;nitrobenzene |
| SMILES | CC1C(C(=O)O)=CC=CC1(C(=O)O)C(F)F.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C10H10F2O4.C6H5NO2/c1-5-6(7(13)14)3-2-4-10(5,8(11)12)9(15)16;8-7(9)6-4-2-1-3-5-6/h2-5,8H,1H3,(H,13,14)(H,15,16);1-5H |
| InChIKey | GUFPITLRRBWSRP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|