About 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid
1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174332346) has the molecular formula C9H10O5
and a molecular weight of 198.17 g/mol. Its IUPAC name is 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
Analyze 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The IUPAC name of 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (CID 174332346) is 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
What is the SMILES notation for 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The canonical SMILES for 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid is CC1C(C(=O)O)=CC=CC1(O)C(=O)O.
What is the InChIKey of 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The InChIKey is CZCQIDMBRMGRQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5/c1-5-6(7(10)11)3-2-4-9(5,14)8(12)13/h2-5,14H,1H3,(H,10,11)(H,12,13).
What are the key properties of 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid has a molecular weight of 198.17 g/mol, XLogP of 0.02, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid is sourced from PubChem (CID 174332346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).