C10H10O6 — CID 151386105
2-methylcyclohexa-3,5-diene-1,1,3-tricarboxylic acid (PubChem CID 151386105) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is 2-methylcyclohexa-3,5-diene-1,1,3-tricarboxylic acid.
| Compound Name | 2-methylcyclohexa-3,5-diene-1,1,3-tricarboxylic acid |
|---|---|
| PubChem CID | 151386105 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-methylcyclohexa-3,5-diene-1,1,3-tricarboxylic acid |
| SMILES | CC1C(C(=O)O)=CC=CC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H10O6/c1-5-6(7(11)12)3-2-4-10(5,8(13)14)9(15)16/h2-5H,1H3,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | OTKZTYBTUZLPLN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|