C15H26NO6P — CID 159083638
1-[hydroxy(propyl)phosphoryl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine (PubChem CID 159083638) has the molecular formula C15H26NO6P and a molecular weight of 347.35 g/mol. Its IUPAC name is 1-[hydroxy(propyl)phosphoryl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine.
| Compound Name | 1-[hydroxy(propyl)phosphoryl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine |
|---|---|
| PubChem CID | 159083638 |
| Molecular Formula | C15H26NO6P |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[hydroxy(propyl)phosphoryl]-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-1-amine |
| SMILES | CCCN.CCCP(=O)(O)C1(C(=O)O)C=CC=C(C(=O)O)C1C |
| InChI | InChI=1S/C12H17O6P.C3H9N/c1-3-7-19(17,18)12(11(15)16)6-4-5-9(8(12)2)10(13)14;1-2-3-4/h4-6,8H,3,7H2,1-2H3,(H,13,14)(H,15,16)(H,17,18);2-4H2,1H3 |
| InChIKey | KBDYKDKQFNGEJN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|