C12H17BrO2 — CID 69263400
5-(bromomethyl)-5,6-diethylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 69263400) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is 5-(bromomethyl)-5,6-diethylcyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5-(bromomethyl)-5,6-diethylcyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 69263400 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-(bromomethyl)-5,6-diethylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CCC1C(C(=O)O)=CC=CC1(CC)CBr |
| InChI | InChI=1S/C12H17BrO2/c1-3-10-9(11(14)15)6-5-7-12(10,4-2)8-13/h5-7,10H,3-4,8H2,1-2H3,(H,14,15) |
| InChIKey | XZQCHWKDJMXLNA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|