C15H12INO6 — CID 174649137
(1R)-1-(4-iodo-2-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174649137) has the molecular formula C15H12INO6 and a molecular weight of 429.17 g/mol. Its IUPAC name is (1R)-1-(4-iodo-2-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | (1R)-1-(4-iodo-2-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174649137 |
| Molecular Formula | C15H12INO6 |
| Molecular Weight | 429.17 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | (1R)-1-(4-iodo-2-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1C(C(=O)O)=CC=C[C@]1(C(=O)O)c1ccc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12INO6/c1-8-10(13(18)19)3-2-6-15(8,14(20)21)11-5-4-9(16)7-12(11)17(22)23/h2-8H,1H3,(H,18,19)(H,20,21)/t8?,15-/m1/s1 |
| InChIKey | SAHMZSBCQCTGJH-LXCSWDKBSA-N |
| XLogP | 2.74 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|