C18H18FNO7 — CID 158299329
1-(4-fluoro-3-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-2-one (PubChem CID 158299329) has the molecular formula C18H18FNO7 and a molecular weight of 379.34 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-2-one.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-2-one |
|---|---|
| PubChem CID | 158299329 |
| Molecular Formula | C18H18FNO7 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propan-2-one |
| SMILES | CC(C)=O.CC1C(C(=O)O)=CC=CC1(C(=O)O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12FNO6.C3H6O/c1-8-10(13(18)19)3-2-6-15(8,14(20)21)9-4-5-11(16)12(7-9)17(22)23;1-3(2)4/h2-8H,1H3,(H,18,19)(H,20,21);1-2H3 |
| InChIKey | GMHQFRCGEPYPPC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|