C9H8FNO5 — CID 95997423
(3S)-3-(4-fluoro-3-nitrophenyl)-3-hydroxypropanoic acid (PubChem CID 95997423) has the molecular formula C9H8FNO5 and a molecular weight of 229.16 g/mol. Its IUPAC name is (3S)-3-(4-fluoro-3-nitrophenyl)-3-hydroxypropanoic acid.
| Compound Name | (3S)-3-(4-fluoro-3-nitrophenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 95997423 |
| Molecular Formula | C9H8FNO5 |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | (3S)-3-(4-fluoro-3-nitrophenyl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)C[C@H](O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H8FNO5/c10-6-2-1-5(3-7(6)11(15)16)8(12)4-9(13)14/h1-3,8,12H,4H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | QMOFGPMEBVQVQI-QMMMGPOBSA-N |
| XLogP | 1.24 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|