C11H13FN2O3 — CID 82315318
2-(cyclopropylamino)-1-(4-fluoro-3-nitrophenyl)ethanol (PubChem CID 82315318) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1-(4-fluoro-3-nitrophenyl)ethanol.
| Compound Name | 2-(cyclopropylamino)-1-(4-fluoro-3-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 82315318 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(cyclopropylamino)-1-(4-fluoro-3-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1cc(C(O)CNC2CC2)ccc1F |
| InChI | InChI=1S/C11H13FN2O3/c12-9-4-1-7(5-10(9)14(16)17)11(15)6-13-8-2-3-8/h1,4-5,8,11,13,15H,2-3,6H2 |
| InChIKey | RPFZWZMISLHIDB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|