C15H12F2N2O4 — CID 55652813
N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-2-nitrobenzamide (PubChem CID 55652813) has the molecular formula C15H12F2N2O4 and a molecular weight of 322.27 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-2-nitrobenzamide.
| Compound Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 55652813 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-2-nitrobenzamide |
| SMILES | O=C(NCC(O)c1ccc(F)c(F)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12F2N2O4/c16-11-6-5-9(7-12(11)17)14(20)8-18-15(21)10-3-1-2-4-13(10)19(22)23/h1-7,14,20H,8H2,(H,18,21) |
| InChIKey | ZAKSUIWRWSNXRW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|