C16H13F3N2O4 — CID 90534706
N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-nitrobenzamide (PubChem CID 90534706) has the molecular formula C16H13F3N2O4 and a molecular weight of 354.28 g/mol. Its IUPAC name is N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-nitrobenzamide.
| Compound Name | N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 90534706 |
| Molecular Formula | C16H13F3N2O4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-nitrobenzamide |
| SMILES | O=C(NCC(O)c1ccc(C(F)(F)F)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13F3N2O4/c17-16(18,19)11-7-5-10(6-8-11)14(22)9-20-15(23)12-3-1-2-4-13(12)21(24)25/h1-8,14,22H,9H2,(H,20,23) |
| InChIKey | UXJXJJYDOHVGHR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|