C12H9FN2O10 — CID 21263965
2-[N-(dicarboxymethyl)-4-fluoro-3-nitroanilino]propanedioic acid (PubChem CID 21263965) has the molecular formula C12H9FN2O10 and a molecular weight of 360.21 g/mol. Its IUPAC name is 2-[N-(dicarboxymethyl)-4-fluoro-3-nitroanilino]propanedioic acid.
| Compound Name | 2-[N-(dicarboxymethyl)-4-fluoro-3-nitroanilino]propanedioic acid |
|---|---|
| PubChem CID | 21263965 |
| Molecular Formula | C12H9FN2O10 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-[N-(dicarboxymethyl)-4-fluoro-3-nitroanilino]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)N(c1ccc(F)c([N+](=O)[O-])c1)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H9FN2O10/c13-5-2-1-4(3-6(5)15(24)25)14(7(9(16)17)10(18)19)8(11(20)21)12(22)23/h1-3,7-8H,(H,16,17)(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | JTVBHSCSJSOBKY-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 195.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|