C12H13FN2O6 — CID 44514147
2-amino-4-[(4-(19F)fluoro-3-nitrophenyl)methyl]pentanedioic acid (PubChem CID 44514147) has the molecular formula C12H13FN2O6 and a molecular weight of 300.24 g/mol. Its IUPAC name is 2-amino-4-[(4-(19F)fluoro-3-nitrophenyl)methyl]pentanedioic acid.
| Compound Name | 2-amino-4-[(4-(19F)fluoro-3-nitrophenyl)methyl]pentanedioic acid |
|---|---|
| PubChem CID | 44514147 |
| Molecular Formula | C12H13FN2O6 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-amino-4-[(4-(19F)fluoro-3-nitrophenyl)methyl]pentanedioic acid |
| SMILES | NC(CC(Cc1ccc([19F])c([N+](=O)[O-])c1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H13FN2O6/c13-8-2-1-6(4-10(8)15(20)21)3-7(11(16)17)5-9(14)12(18)19/h1-2,4,7,9H,3,5,14H2,(H,16,17)(H,18,19)/i13+0 |
| InChIKey | KYAHEFOBMKTIRQ-XFLZAFPTSA-N |
| XLogP | 0.78 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|