C15H16N2O6 — CID 175513731
2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid;phenol (PubChem CID 175513731) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid;phenol.
| Compound Name | 2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid;phenol |
|---|---|
| PubChem CID | 175513731 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid;phenol |
| SMILES | NC(Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)O.Oc1ccccc1 |
| InChI | InChI=1S/C9H10N2O5.C6H6O/c10-6(9(13)14)3-5-1-2-8(12)7(4-5)11(15)16;7-6-4-2-1-3-5-6/h1-2,4,6,12H,3,10H2,(H,13,14);1-5,7H |
| InChIKey | BTQCKHPOWZWLOE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|