C13H12N4O4S — CID 170879876
2-amino-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)propanoic acid (PubChem CID 170879876) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-amino-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 170879876 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-amino-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)propanoic acid |
| SMILES | NC(Cc1ccc(Sc2ncccn2)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C13H12N4O4S/c14-9(12(18)19)6-8-2-3-11(10(7-8)17(20)21)22-13-15-4-1-5-16-13/h1-5,7,9H,6,14H2,(H,18,19) |
| InChIKey | UQGZGKDGUSASPL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|