C9H9BrN2O5 — CID 170692685
(2S)-2-amino-3-(3-bromo-4-hydroxy-5-nitrophenyl)propanoic acid (PubChem CID 170692685) has the molecular formula C9H9BrN2O5 and a molecular weight of 305.08 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-bromo-4-hydroxy-5-nitrophenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(3-bromo-4-hydroxy-5-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 170692685 |
| Molecular Formula | C9H9BrN2O5 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | (2S)-2-amino-3-(3-bromo-4-hydroxy-5-nitrophenyl)propanoic acid |
| SMILES | N[C@@H](Cc1cc(Br)c(O)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C9H9BrN2O5/c10-5-1-4(2-6(11)9(14)15)3-7(8(5)13)12(16)17/h1,3,6,13H,2,11H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | OBBRAVSWGURSPS-LURJTMIESA-N |
| XLogP | 1.02 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|