C9H9N3O7 — CID 175337913
2-amino-3-(4-hydroxy-2,6-dinitrophenyl)propanoic acid (PubChem CID 175337913) has the molecular formula C9H9N3O7 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxy-2,6-dinitrophenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-hydroxy-2,6-dinitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 175337913 |
| Molecular Formula | C9H9N3O7 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-amino-3-(4-hydroxy-2,6-dinitrophenyl)propanoic acid |
| SMILES | NC(Cc1c([N+](=O)[O-])cc(O)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H9N3O7/c10-6(9(14)15)3-5-7(11(16)17)1-4(13)2-8(5)12(18)19/h1-2,6,13H,3,10H2,(H,14,15) |
| InChIKey | FPWDZBWXUBNXIP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|