C9H9NO5P2 — CID 175570166
(2S)-2-amino-3-(4-hydroxy-2,6-diphosphorosophenyl)propanoic acid (PubChem CID 175570166) has the molecular formula C9H9NO5P2 and a molecular weight of 273.12 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxy-2,6-diphosphorosophenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(4-hydroxy-2,6-diphosphorosophenyl)propanoic acid |
|---|---|
| PubChem CID | 175570166 |
| Molecular Formula | C9H9NO5P2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxy-2,6-diphosphorosophenyl)propanoic acid |
| SMILES | N[C@@H](Cc1c(P=O)cc(O)cc1P=O)C(=O)O |
| InChI | InChI=1S/C9H9NO5P2/c10-6(9(12)13)3-5-7(16-14)1-4(11)2-8(5)17-15/h1-2,6,11H,3,10H2,(H,12,13)/t6-/m0/s1 |
| InChIKey | YABQJEOMTWMFIX-LURJTMIESA-N |
| XLogP | 0.18 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|