C9H10N2O6 — CID 19389246
2-amino-3-(3,4-dihydroxy-5-nitrophenyl)propanoic acid (PubChem CID 19389246) has the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxy-5-nitrophenyl)propanoic acid.
| Compound Name | 2-amino-3-(3,4-dihydroxy-5-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 19389246 |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxy-5-nitrophenyl)propanoic acid |
| SMILES | NC(Cc1cc(O)c(O)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C9H10N2O6/c10-5(9(14)15)1-4-2-6(11(16)17)8(13)7(12)3-4/h2-3,5,12-13H,1,10H2,(H,14,15) |
| InChIKey | RHJKGZQPTILUNH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|