C20H24N2O11 — CID 57062286
5-[3-[3-(3,4-dihydroxy-5-nitrophenyl)-2-methoxypropoxy]-2-methoxypropyl]-3-nitrobenzene-1,2-diol (PubChem CID 57062286) has the molecular formula C20H24N2O11 and a molecular weight of 468.42 g/mol. Its IUPAC name is 5-[3-[3-(3,4-dihydroxy-5-nitrophenyl)-2-methoxypropoxy]-2-methoxypropyl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[3-[3-(3,4-dihydroxy-5-nitrophenyl)-2-methoxypropoxy]-2-methoxypropyl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 57062286 |
| Molecular Formula | C20H24N2O11 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 5-[3-[3-(3,4-dihydroxy-5-nitrophenyl)-2-methoxypropoxy]-2-methoxypropyl]-3-nitrobenzene-1,2-diol |
| SMILES | COC(COCC(Cc1cc(O)c(O)c([N+](=O)[O-])c1)OC)Cc1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N2O11/c1-31-13(3-11-5-15(21(27)28)19(25)17(23)7-11)9-33-10-14(32-2)4-12-6-16(22(29)30)20(26)18(24)8-12/h5-8,13-14,23-26H,3-4,9-10H2,1-2H3 |
| InChIKey | GXHFTPOHUPPXDP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 194.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|