C17H17NO6 — CID 112720335
3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(4-methylphenyl)propanoic acid (PubChem CID 112720335) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(4-methylphenyl)propanoic acid.
| Compound Name | 3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 112720335 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-(4-methylphenyl)propanoic acid |
| SMILES | COc1cc(CC(C(=O)O)c2ccc(C)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H17NO6/c1-10-3-5-12(6-4-10)13(17(20)21)7-11-8-14(18(22)23)16(19)15(9-11)24-2/h3-6,8-9,13,19H,7H2,1-2H3,(H,20,21) |
| InChIKey | AMUNIXOYPOHOSU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|