C18H21NO5 — CID 83955719
2-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 83955719) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)propanoic acid.
| Compound Name | 2-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83955719 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(4-aminophenyl)-3-(3,4,5-trimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(CC(C(=O)O)c2ccc(N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21NO5/c1-22-15-9-11(10-16(23-2)17(15)24-3)8-14(18(20)21)12-4-6-13(19)7-5-12/h4-7,9-10,14H,8,19H2,1-3H3,(H,20,21) |
| InChIKey | VRBWRVCOAOUEPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|