C16H17NO3 — CID 82026703
2-(4-aminophenyl)-3-(2-methoxyphenyl)propanoic acid (PubChem CID 82026703) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3-(2-methoxyphenyl)propanoic acid.
| Compound Name | 2-(4-aminophenyl)-3-(2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 82026703 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(4-aminophenyl)-3-(2-methoxyphenyl)propanoic acid |
| SMILES | COc1ccccc1CC(C(=O)O)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-20-15-5-3-2-4-12(15)10-14(16(18)19)11-6-8-13(17)9-7-11/h2-9,14H,10,17H2,1H3,(H,18,19) |
| InChIKey | NISPBVNHDVTDRR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|