C16H14F3NO2 — CID 83950622
2-(4-aminophenyl)-3-[2-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 83950622) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3-[2-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-(4-aminophenyl)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 83950622 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-(4-aminophenyl)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | Nc1ccc(C(Cc2ccccc2C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C16H14F3NO2/c17-16(18,19)14-4-2-1-3-11(14)9-13(15(21)22)10-5-7-12(20)8-6-10/h1-8,13H,9,20H2,(H,21,22) |
| InChIKey | MHUIOBNPBCZVEE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|