C19H19F3O3 — CID 10498178
2-(4-propan-2-ylphenoxy)-3-[2-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 10498178) has the molecular formula C19H19F3O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-(4-propan-2-ylphenoxy)-3-[2-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-(4-propan-2-ylphenoxy)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 10498178 |
| Molecular Formula | C19H19F3O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-(4-propan-2-ylphenoxy)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(C)c1ccc(OC(Cc2ccccc2C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C19H19F3O3/c1-12(2)13-7-9-15(10-8-13)25-17(18(23)24)11-14-5-3-4-6-16(14)19(20,21)22/h3-10,12,17H,11H2,1-2H3,(H,23,24) |
| InChIKey | ZCKZBNARBRXSCN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |