C22H20O3 — CID 100524579
(2R)-3-(2-methylphenyl)-2-(4-phenylphenoxy)propanoic acid (PubChem CID 100524579) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2R)-3-(2-methylphenyl)-2-(4-phenylphenoxy)propanoic acid.
| Compound Name | (2R)-3-(2-methylphenyl)-2-(4-phenylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100524579 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2R)-3-(2-methylphenyl)-2-(4-phenylphenoxy)propanoic acid |
| SMILES | Cc1ccccc1C[C@@H](Oc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H20O3/c1-16-7-5-6-10-19(16)15-21(22(23)24)25-20-13-11-18(12-14-20)17-8-3-2-4-9-17/h2-14,21H,15H2,1H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | MYFPBZPEHRGOFV-OAQYLSRUSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |