C23H22O3 — CID 100530411
(2R)-3-(4-ethylphenyl)-2-(4-phenylphenoxy)propanoic acid (PubChem CID 100530411) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R)-3-(4-ethylphenyl)-2-(4-phenylphenoxy)propanoic acid.
| Compound Name | (2R)-3-(4-ethylphenyl)-2-(4-phenylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100530411 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2R)-3-(4-ethylphenyl)-2-(4-phenylphenoxy)propanoic acid |
| SMILES | CCc1ccc(C[C@@H](Oc2ccc(-c3ccccc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C23H22O3/c1-2-17-8-10-18(11-9-17)16-22(23(24)25)26-21-14-12-20(13-15-21)19-6-4-3-5-7-19/h3-15,22H,2,16H2,1H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | MPKWHDKSQRQFRS-JOCHJYFZSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |