C22H20O3S — CID 100549442
(2S)-2-(4-methylphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid (PubChem CID 100549442) has the molecular formula C22H20O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2S)-2-(4-methylphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid.
| Compound Name | (2S)-2-(4-methylphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100549442 |
| Molecular Formula | C22H20O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2S)-2-(4-methylphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid |
| SMILES | Cc1ccc(O[C@@H](Cc2ccccc2Sc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H20O3S/c1-16-11-13-18(14-12-16)25-20(22(23)24)15-17-7-5-6-10-21(17)26-19-8-3-2-4-9-19/h2-14,20H,15H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | PBKNWWQVXFPLCO-FQEVSTJZSA-N |
| XLogP | 5.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |