C22H20O4S — CID 100549683
(2S)-2-(4-methoxyphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid (PubChem CID 100549683) has the molecular formula C22H20O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid.
| Compound Name | (2S)-2-(4-methoxyphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100549683 |
| Molecular Formula | C22H20O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (2S)-2-(4-methoxyphenoxy)-3-(2-phenylsulfanylphenyl)propanoic acid |
| SMILES | COc1ccc(O[C@@H](Cc2ccccc2Sc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H20O4S/c1-25-17-11-13-18(14-12-17)26-20(22(23)24)15-16-7-5-6-10-21(16)27-19-8-3-2-4-9-19/h2-14,20H,15H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | ULPLOXJGWUISHD-FQEVSTJZSA-N |
| XLogP | 4.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |