C15H13BrO2S — CID 100523970
(2R)-2-bromo-3-(2-phenylsulfanylphenyl)propanoic acid (PubChem CID 100523970) has the molecular formula C15H13BrO2S and a molecular weight of 337.24 g/mol. Its IUPAC name is (2R)-2-bromo-3-(2-phenylsulfanylphenyl)propanoic acid.
| Compound Name | (2R)-2-bromo-3-(2-phenylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100523970 |
| Molecular Formula | C15H13BrO2S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | (2R)-2-bromo-3-(2-phenylsulfanylphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Br)Cc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C15H13BrO2S/c16-13(15(17)18)10-11-6-4-5-9-14(11)19-12-7-2-1-3-8-12/h1-9,13H,10H2,(H,17,18)/t13-/m1/s1 |
| InChIKey | SSSFBYKHVPFOFZ-CYBMUJFWSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|