C25H26N2O2S — CID 100554100
(2S)-2-(4-phenylpiperazin-1-yl)-3-(2-phenylsulfanylphenyl)propanoic acid (PubChem CID 100554100) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is (2S)-2-(4-phenylpiperazin-1-yl)-3-(2-phenylsulfanylphenyl)propanoic acid.
| Compound Name | (2S)-2-(4-phenylpiperazin-1-yl)-3-(2-phenylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100554100 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (2S)-2-(4-phenylpiperazin-1-yl)-3-(2-phenylsulfanylphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1Sc1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H26N2O2S/c28-25(29)23(27-17-15-26(16-18-27)21-10-3-1-4-11-21)19-20-9-7-8-14-24(20)30-22-12-5-2-6-13-22/h1-14,23H,15-19H2,(H,28,29)/t23-/m0/s1 |
| InChIKey | NFIQQJWYMLBYFW-QHCPKHFHSA-N |
| XLogP | 4.66 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |