C16H16O3S — CID 133239287
2-methoxy-3-(2-phenylsulfanylphenyl)propanoic acid (PubChem CID 133239287) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-methoxy-3-(2-phenylsulfanylphenyl)propanoic acid.
| Compound Name | 2-methoxy-3-(2-phenylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 133239287 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-methoxy-3-(2-phenylsulfanylphenyl)propanoic acid |
| SMILES | COC(Cc1ccccc1Sc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H16O3S/c1-19-14(16(17)18)11-12-7-5-6-10-15(12)20-13-8-3-2-4-9-13/h2-10,14H,11H2,1H3,(H,17,18) |
| InChIKey | UOEFKPPTQUTCGF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |