C14H18F3NO2 — CID 69270720
2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 69270720) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 69270720 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CC(Cc1ccccc1C(F)(F)F)CC(CN)C(=O)O |
| InChI | InChI=1S/C14H18F3NO2/c1-9(7-11(8-18)13(19)20)6-10-4-2-3-5-12(10)14(15,16)17/h2-5,9,11H,6-8,18H2,1H3,(H,19,20) |
| InChIKey | QKJFWMFRXMIDOS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |