C15H20F3NO2 — CID 11738208
2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]hexanoic acid (PubChem CID 11738208) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]hexanoic acid.
| Compound Name | 2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 11738208 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-5-[2-(trifluoromethyl)phenyl]hexanoic acid |
| SMILES | CC(CC(CN)C(=O)O)C(C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H20F3NO2/c1-9(7-11(8-19)14(20)21)10(2)12-5-3-4-6-13(12)15(16,17)18/h3-6,9-11H,7-8,19H2,1-2H3,(H,20,21) |
| InChIKey | XOECHZJEVYDOBJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |