C13H16F3NO2 — CID 69266892
2-(aminomethyl)-4-[2-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 69266892) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-(aminomethyl)-4-[2-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 2-(aminomethyl)-4-[2-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 69266892 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-(aminomethyl)-4-[2-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CC(CC(CN)C(=O)O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2/c1-8(6-9(7-17)12(18)19)10-4-2-3-5-11(10)13(14,15)16/h2-5,8-9H,6-7,17H2,1H3,(H,18,19) |
| InChIKey | YTGCNNDAUZRJOX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |