C17H21F6NO2 — CID 87760653
2-(aminomethyl)-6-[2,3-bis(trifluoromethyl)phenyl]-4-ethylhexanoic acid (PubChem CID 87760653) has the molecular formula C17H21F6NO2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 2-(aminomethyl)-6-[2,3-bis(trifluoromethyl)phenyl]-4-ethylhexanoic acid.
| Compound Name | 2-(aminomethyl)-6-[2,3-bis(trifluoromethyl)phenyl]-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 87760653 |
| Molecular Formula | C17H21F6NO2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-(aminomethyl)-6-[2,3-bis(trifluoromethyl)phenyl]-4-ethylhexanoic acid |
| SMILES | CCC(CCc1cccc(C(F)(F)F)c1C(F)(F)F)CC(CN)C(=O)O |
| InChI | InChI=1S/C17H21F6NO2/c1-2-10(8-12(9-24)15(25)26)6-7-11-4-3-5-13(16(18,19)20)14(11)17(21,22)23/h3-5,10,12H,2,6-9,24H2,1H3,(H,25,26) |
| InChIKey | UOBKLNURBGZGPB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |