C15H21Cl2NO2 — CID 69269632
2-(aminomethyl)-6-(2,6-dichlorophenyl)-4-ethylhexanoic acid (PubChem CID 69269632) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is 2-(aminomethyl)-6-(2,6-dichlorophenyl)-4-ethylhexanoic acid.
| Compound Name | 2-(aminomethyl)-6-(2,6-dichlorophenyl)-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 69269632 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-(aminomethyl)-6-(2,6-dichlorophenyl)-4-ethylhexanoic acid |
| SMILES | CCC(CCc1c(Cl)cccc1Cl)CC(CN)C(=O)O |
| InChI | InChI=1S/C15H21Cl2NO2/c1-2-10(8-11(9-18)15(19)20)6-7-12-13(16)4-3-5-14(12)17/h3-5,10-11H,2,6-9,18H2,1H3,(H,19,20) |
| InChIKey | XFSADLONMBXIEO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |