C16H24ClNO2 — CID 69269987
2-(aminomethyl)-7-(3-chlorophenyl)-5-ethylheptanoic acid (PubChem CID 69269987) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-(aminomethyl)-7-(3-chlorophenyl)-5-ethylheptanoic acid.
| Compound Name | 2-(aminomethyl)-7-(3-chlorophenyl)-5-ethylheptanoic acid |
|---|---|
| PubChem CID | 69269987 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(aminomethyl)-7-(3-chlorophenyl)-5-ethylheptanoic acid |
| SMILES | CCC(CCc1cccc(Cl)c1)CCC(CN)C(=O)O |
| InChI | InChI=1S/C16H24ClNO2/c1-2-12(8-9-14(11-18)16(19)20)6-7-13-4-3-5-15(17)10-13/h3-5,10,12,14H,2,6-9,11,18H2,1H3,(H,19,20) |
| InChIKey | QWGTUWTYTNCMNU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |