C16H19F6NO4 — CID 87760462
2-(aminomethyl)-5-[3,5-bis(trifluoromethoxy)phenyl]-4-methylhexanoic acid (PubChem CID 87760462) has the molecular formula C16H19F6NO4 and a molecular weight of 403.32 g/mol. Its IUPAC name is 2-(aminomethyl)-5-[3,5-bis(trifluoromethoxy)phenyl]-4-methylhexanoic acid.
| Compound Name | 2-(aminomethyl)-5-[3,5-bis(trifluoromethoxy)phenyl]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 87760462 |
| Molecular Formula | C16H19F6NO4 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-(aminomethyl)-5-[3,5-bis(trifluoromethoxy)phenyl]-4-methylhexanoic acid |
| SMILES | CC(CC(CN)C(=O)O)C(C)c1cc(OC(F)(F)F)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F6NO4/c1-8(3-11(7-23)14(24)25)9(2)10-4-12(26-15(17,18)19)6-13(5-10)27-16(20,21)22/h4-6,8-9,11H,3,7,23H2,1-2H3,(H,24,25) |
| InChIKey | JTMZXLPUOCJFMO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |