C15H20F3NO3 — CID 151295570
2-amino-2,4-dimethyl-5-[3-(trifluoromethoxy)phenyl]hexanoic acid (PubChem CID 151295570) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-amino-2,4-dimethyl-5-[3-(trifluoromethoxy)phenyl]hexanoic acid.
| Compound Name | 2-amino-2,4-dimethyl-5-[3-(trifluoromethoxy)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 151295570 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-amino-2,4-dimethyl-5-[3-(trifluoromethoxy)phenyl]hexanoic acid |
| SMILES | CC(CC(C)(N)C(=O)O)C(C)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO3/c1-9(8-14(3,19)13(20)21)10(2)11-5-4-6-12(7-11)22-15(16,17)18/h4-7,9-10H,8,19H2,1-3H3,(H,20,21) |
| InChIKey | OBIJMWBOJBEPKD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |