C16H17F6NO2 — CID 153423675
(3S)-3-[3-(trifluoromethoxy)phenyl]-2-[[1-(trifluoromethyl)cyclopropyl]methyl]butanamide (PubChem CID 153423675) has the molecular formula C16H17F6NO2 and a molecular weight of 369.31 g/mol. Its IUPAC name is (3S)-3-[3-(trifluoromethoxy)phenyl]-2-[[1-(trifluoromethyl)cyclopropyl]methyl]butanamide.
| Compound Name | (3S)-3-[3-(trifluoromethoxy)phenyl]-2-[[1-(trifluoromethyl)cyclopropyl]methyl]butanamide |
|---|---|
| PubChem CID | 153423675 |
| Molecular Formula | C16H17F6NO2 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3S)-3-[3-(trifluoromethoxy)phenyl]-2-[[1-(trifluoromethyl)cyclopropyl]methyl]butanamide |
| SMILES | C[C@H](c1cccc(OC(F)(F)F)c1)C(CC1(C(F)(F)F)CC1)C(N)=O |
| InChI | InChI=1S/C16H17F6NO2/c1-9(10-3-2-4-11(7-10)25-16(20,21)22)12(13(23)24)8-14(5-6-14)15(17,18)19/h2-4,7,9,12H,5-6,8H2,1H3,(H2,23,24)/t9-,12?/m1/s1 |
| InChIKey | XBIBBJWVCVKZJH-PKEIRNPWSA-N |
| XLogP | 4.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |