C15H13ClO3 — CID 99646181
(2S)-3-(2-chlorophenyl)-2-phenoxypropanoic acid (PubChem CID 99646181) has the molecular formula C15H13ClO3 and a molecular weight of 276.72 g/mol. Its IUPAC name is (2S)-3-(2-chlorophenyl)-2-phenoxypropanoic acid.
| Compound Name | (2S)-3-(2-chlorophenyl)-2-phenoxypropanoic acid |
|---|---|
| PubChem CID | 99646181 |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (2S)-3-(2-chlorophenyl)-2-phenoxypropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1Cl)Oc1ccccc1 |
| InChI | InChI=1S/C15H13ClO3/c16-13-9-5-4-6-11(13)10-14(15(17)18)19-12-7-2-1-3-8-12/h1-9,14H,10H2,(H,17,18)/t14-/m0/s1 |
| InChIKey | CFRFRXYKYGEJTC-AWEZNQCLSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |