3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid

C17H16Cl2O3 — CID 133245581

IUPAC3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid
SMILESCc1cc(C)cc(OC(Cc2cccc(Cl)c2Cl)C(=O)O)c1
InChIInChI=1S/C17H16Cl2O3/c1-10-6-11(2)8-13(7-10)22-15(17(20)21)9-12-4-3-5-14(18)16(12)19/h3-8,15H,9H2,1-2H3,(H,20,21)
InChIKeyFKGIWYBYDHEMGI-UHFFFAOYSA-N
MW339.22 g/mol
LogP4.68
Rot. Bonds5

About 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid

3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid (PubChem CID 133245581) has the molecular formula C17H16Cl2O3 and a molecular weight of 339.22 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid.

Molecular Properties

Compound Name3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid
PubChem CID133245581
Molecular FormulaC17H16Cl2O3
Molecular Weight339.22 g/mol
Exact Mass338.05
IUPAC Name3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid
SMILESCc1cc(C)cc(OC(Cc2cccc(Cl)c2Cl)C(=O)O)c1
InChIInChI=1S/C17H16Cl2O3/c1-10-6-11(2)8-13(7-10)22-15(17(20)21)9-12-4-3-5-14(18)16(12)19/h3-8,15H,9H2,1-2H3,(H,20,21)
InChIKeyFKGIWYBYDHEMGI-UHFFFAOYSA-N
XLogP4.68
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.22
LogP ≤ 54.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid?
The IUPAC name of 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid (CID 133245581) is 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid.
What is the SMILES notation for 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid?
The canonical SMILES for 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid is Cc1cc(C)cc(OC(Cc2cccc(Cl)c2Cl)C(=O)O)c1.
What is the InChIKey of 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid?
The InChIKey is FKGIWYBYDHEMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2O3/c1-10-6-11(2)8-13(7-10)22-15(17(20)21)9-12-4-3-5-14(18)16(12)19/h3-8,15H,9H2,1-2H3,(H,20,21).
What are the key properties of 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid?
3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid has a molecular weight of 339.22 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dichlorophenyl)-2-(3,5-dimethylphenoxy)propanoic acid is sourced from PubChem (CID 133245581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).