(2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid

C18H20O4 — CID 100542546

IUPAC(2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid
SMILESCOc1cccc(C[C@@H](Oc2cc(C)cc(C)c2)C(=O)O)c1
InChIInChI=1S/C18H20O4/c1-12-7-13(2)9-16(8-12)22-17(18(19)20)11-14-5-4-6-15(10-14)21-3/h4-10,17H,11H2,1-3H3,(H,19,20)/t17-/m1/s1
InChIKeyQXYXTHRYDRRWQG-QGZVFWFLSA-N
MW300.35 g/mol
LogP3.39
Rot. Bonds6

About (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid

(2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid (PubChem CID 100542546) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid
PubChem CID100542546
Molecular FormulaC18H20O4
Molecular Weight300.35 g/mol
Exact Mass300.14
IUPAC Name(2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid
SMILESCOc1cccc(C[C@@H](Oc2cc(C)cc(C)c2)C(=O)O)c1
InChIInChI=1S/C18H20O4/c1-12-7-13(2)9-16(8-12)22-17(18(19)20)11-14-5-4-6-15(10-14)21-3/h4-10,17H,11H2,1-3H3,(H,19,20)/t17-/m1/s1
InChIKeyQXYXTHRYDRRWQG-QGZVFWFLSA-N
XLogP3.39
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.35
LogP ≤ 53.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid?
The IUPAC name of (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid (CID 100542546) is (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid.
What is the SMILES notation for (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid?
The canonical SMILES for (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid is COc1cccc(C[C@@H](Oc2cc(C)cc(C)c2)C(=O)O)c1.
What is the InChIKey of (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid?
The InChIKey is QXYXTHRYDRRWQG-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H20O4/c1-12-7-13(2)9-16(8-12)22-17(18(19)20)11-14-5-4-6-15(10-14)21-3/h4-10,17H,11H2,1-3H3,(H,19,20)/t17-/m1/s1.
What are the key properties of (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid?
(2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid has a molecular weight of 300.35 g/mol, XLogP of 3.39, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,5-dimethylphenoxy)-3-(3-methoxyphenyl)propanoic acid is sourced from PubChem (CID 100542546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).