C14H20O4 — CID 133241017
3-(3-methoxyphenyl)-2-(2-methylpropoxy)propanoic acid (PubChem CID 133241017) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2-(2-methylpropoxy)propanoic acid.
| Compound Name | 3-(3-methoxyphenyl)-2-(2-methylpropoxy)propanoic acid |
|---|---|
| PubChem CID | 133241017 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-(3-methoxyphenyl)-2-(2-methylpropoxy)propanoic acid |
| SMILES | COc1cccc(CC(OCC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C14H20O4/c1-10(2)9-18-13(14(15)16)8-11-5-4-6-12(7-11)17-3/h4-7,10,13H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | OVCQTCURBLINQW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |