C18H21NO3 — CID 83954423
2-(4-aminophenyl)-3-(2-propoxyphenyl)propanoic acid (PubChem CID 83954423) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3-(2-propoxyphenyl)propanoic acid.
| Compound Name | 2-(4-aminophenyl)-3-(2-propoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83954423 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-(4-aminophenyl)-3-(2-propoxyphenyl)propanoic acid |
| SMILES | CCCOc1ccccc1CC(C(=O)O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-2-11-22-17-6-4-3-5-14(17)12-16(18(20)21)13-7-9-15(19)10-8-13/h3-10,16H,2,11-12,19H2,1H3,(H,20,21) |
| InChIKey | VFOUEDVEOQPXAR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|