C21H25FO3 — CID 83954603
2-(3-fluoro-4-methylphenyl)-3-(2-pentoxyphenyl)propanoic acid (PubChem CID 83954603) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)-3-(2-pentoxyphenyl)propanoic acid.
| Compound Name | 2-(3-fluoro-4-methylphenyl)-3-(2-pentoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83954603 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)-3-(2-pentoxyphenyl)propanoic acid |
| SMILES | CCCCCOc1ccccc1CC(C(=O)O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C21H25FO3/c1-3-4-7-12-25-20-9-6-5-8-17(20)13-18(21(23)24)16-11-10-15(2)19(22)14-16/h5-6,8-11,14,18H,3-4,7,12-13H2,1-2H3,(H,23,24) |
| InChIKey | LWYVKWJHMOFBEJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|