C20H23FO4 — CID 112720099
2-(3-fluoro-4-methylphenyl)-3-(3-methoxy-2-propoxyphenyl)propanoic acid (PubChem CID 112720099) has the molecular formula C20H23FO4 and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)-3-(3-methoxy-2-propoxyphenyl)propanoic acid.
| Compound Name | 2-(3-fluoro-4-methylphenyl)-3-(3-methoxy-2-propoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 112720099 |
| Molecular Formula | C20H23FO4 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)-3-(3-methoxy-2-propoxyphenyl)propanoic acid |
| SMILES | CCCOc1c(CC(C(=O)O)c2ccc(C)c(F)c2)cccc1OC |
| InChI | InChI=1S/C20H23FO4/c1-4-10-25-19-15(6-5-7-18(19)24-3)11-16(20(22)23)14-9-8-13(2)17(21)12-14/h5-9,12,16H,4,10-11H2,1-3H3,(H,22,23) |
| InChIKey | XGLXJKZQEHVEBC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |