C22H28O4 — CID 22685773
3-(2-hexoxy-4-methoxyphenyl)-2-phenylpropanoic acid (PubChem CID 22685773) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-(2-hexoxy-4-methoxyphenyl)-2-phenylpropanoic acid.
| Compound Name | 3-(2-hexoxy-4-methoxyphenyl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 22685773 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-(2-hexoxy-4-methoxyphenyl)-2-phenylpropanoic acid |
| SMILES | CCCCCCOc1cc(OC)ccc1CC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H28O4/c1-3-4-5-9-14-26-21-16-19(25-2)13-12-18(21)15-20(22(23)24)17-10-7-6-8-11-17/h6-8,10-13,16,20H,3-5,9,14-15H2,1-2H3,(H,23,24) |
| InChIKey | SSJUAGGYDLKGPY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|